|  | |  |  | METHYL 2-FLUOROBENZOATE Basic information | 
|  |  | METHYL 2-FLUOROBENZOATE Chemical Properties | 
 | Melting point | 93°C |  | Boiling point | 109-110 °C/35 mmHg (lit.) |  | density | 1.21 g/mL at 25 °C (lit.) |  | refractive index | n20/D 1.502(lit.) |  | Fp | 201 °F |  | storage temp. | Sealed in dry,Room Temperature |  | form | clear liquid |  | color | Colorless to Almost colorless |  | Specific Gravity | 1.210 |  | BRN | 1862493 |  | InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |  | InChIKey | QAFJIJWLEBLXHH-UHFFFAOYSA-N |  | SMILES | C(OC)(=O)C1=CC=CC=C1F |  | CAS DataBase Reference | 394-35-4(CAS DataBase Reference) |  | EPA Substance Registry System | Benzoic acid, 2-fluoro-, methyl ester (394-35-4) | 
| Hazard Codes | T,Xi |  | Risk Statements | 36/38 |  | Safety Statements | 26-36/37/39-37 |  | RIDADR | UN3272 |  | WGK Germany | 3 |  | Hazard Note | Toxic |  | TSCA | Yes |  | HazardClass | 3 |  | PackingGroup | III |  | HS Code | 29163990 | 
|  |  | METHYL 2-FLUOROBENZOATE Usage And Synthesis | 
 | Chemical Properties | Colorless liquid |  | Uses | Methyl 2-fluorobenzoate may be used to synthesize 2-fluoro-α-methylstyrene and 2-fluorophenyldiphenylmethanol. |  | Synthesis Reference(s) | Synthetic Communications, 21, p. 2377, 1991 DOI: 10.1080/00397919108021598 |  | General Description | Methyl 2-fluorobenzoate is an ortho-halogen-substituted methyl benzoate ester. It reacts with hydrazide to afford 2-fluorobenzoic hydrazide. Methyl 2-fluorobenzoate undergoes enzymatic dihydroxylation via the whole-cell fermentation in the presence of Escherichia coli JM109 (pDTG601A) to afford a diol. | 
|  |  | METHYL 2-FLUOROBENZOATE Preparation Products And Raw materials | 
 |