|
| | METHYL 2-FLUOROBENZOATE Basic information |
| | METHYL 2-FLUOROBENZOATE Chemical Properties |
| Melting point | 93°C | | Boiling point | 109-110 °C/35 mmHg (lit.) | | density | 1.21 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.502(lit.) | | Fp | 201 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.210 | | BRN | 1862493 | | InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 | | InChIKey | QAFJIJWLEBLXHH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC=C1F | | CAS DataBase Reference | 394-35-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-fluoro-, methyl ester (394-35-4) |
| Hazard Codes | T,Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36/37/39-37 | | RIDADR | UN3272 | | WGK Germany | 3 | | Hazard Note | Toxic | | TSCA | Yes | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29163990 |
| | METHYL 2-FLUOROBENZOATE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Methyl 2-fluorobenzoate may be used to synthesize 2-fluoro-α-methylstyrene and 2-fluorophenyldiphenylmethanol. | | Synthesis Reference(s) | Synthetic Communications, 21, p. 2377, 1991 DOI: 10.1080/00397919108021598 | | General Description | Methyl 2-fluorobenzoate is an ortho-halogen-substituted methyl benzoate ester. It reacts with hydrazide to afford 2-fluorobenzoic hydrazide. Methyl 2-fluorobenzoate undergoes enzymatic dihydroxylation via the whole-cell fermentation in the presence of Escherichia coli JM109 (pDTG601A) to afford a diol. |
| | METHYL 2-FLUOROBENZOATE Preparation Products And Raw materials |
|