|
| | CHLORTHION Basic information |
| Product Name: | CHLORTHION | | Synonyms: | ent18,861;ent18,861[qr];Methyl chlorothion;methylchlorothion;methylchlorothion[qr];O-(3-Chloor-4-nitro-fenyl)-O,O-dimethyl-monothiofosfaat;o-(3-chloor-4-nitro-fenyl)-o,o-dimethyl-monothiofosfaat[dutch][qr];O-(3-Chlor-4-nitro-phenyl)-O,O-dimethyl-monothiophosphat | | CAS: | 500-28-7 | | MF: | C8H9ClNO5PS | | MW: | 297.65 | | EINECS: | 207-902-5 | | Product Categories: | Alpha sort;C;CAlphabetic;CH;Pesticides&Metabolites | | Mol File: | 500-28-7.mol |  |
| | CHLORTHION Chemical Properties |
| Melting point | 21° | | Boiling point | bp0.1 125° | | density | d420 1.437 | | refractive index | nD20 1.5661 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | Water Solubility | 40mg/L(20 ºC) | | BRN | 2292513 | | EPA Substance Registry System | Chlorthion (500-28-7) |
| | CHLORTHION Usage And Synthesis |
| Uses | Insecticide. | | Definition | ChEBI: Chlorthion is an organic thiophosphate that is O,O-dimethyl O-phenyl phosphorothioate substituted by a chloro group at position 3 and a nitro group at position 4. It is a potent cholinesterase inhibitor and used as an insecticide for the control of a wide range of insects. It has a role as an EC 3.1.1.8 (cholinesterase) inhibitor and an agrochemical. It is a C-nitro compound, an organic thiophosphate, a member of monochlorobenzenes and an organothiophosphate insecticide. |
| | CHLORTHION Preparation Products And Raw materials |
|
