| 
 |  | ARACHIDONIC ACID ETHYL ESTER Basic information |  
 | Product Name: | ARACHIDONIC ACID ETHYL ESTER |  | Synonyms: | 11,14-eicosatetraenoicacid,ethylester,(allz)-8;ethyl5,8,11,14-eicosatetraenoate(allz);DELTA 5 CIS 8 CIS 11 CIS 14 CIS EICOSATETRAENOIC ACID ETHYL ESTER;ETHYL ARACHIDONATE;ARACHIDONIC ACID ETHYL ESTER;arachidonic acid ethyl ester*approx. 90%;ARACHIDONIC ACID ETHYL ESTER APPROX 99%;5,8,11,14-Eicosatetraenoic acid, ethyl ester, (5Z,8Z,11Z,14Z)- |  | CAS: | 1808-26-0 |  | MF: | C22H36O2 |  | MW: | 332.52 |  | EINECS: | 217-314-0 |  | Product Categories: | Fatty Acid Derivatives & Lipids;Glycerols |  | Mol File: | 1808-26-0.mol |    |  
  
 |  | ARACHIDONIC ACID ETHYL ESTER Chemical Properties |  
 | Boiling point  | 418.1±34.0 °C(Predicted) |  | density  | 0.899±0.06 g/cm3(Predicted) |  | storage temp.  | −20°C |  | solubility  | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |  | form  | liquid |  | color  | Clear Colorless |  | Stability: | Light Sensitive, Temperature Sensitive |  | InChI | InChI=1S/C22H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3/b9-8-,12-11-,15-14-,18-17- |  | InChIKey | SNXPWYFWAZVIAU-GKFVBPDJSA-N |  | SMILES | C(OCC)(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |  | LogP | 7.997 (est) |  | CAS DataBase Reference | 1808-26-0(CAS DataBase Reference) |  
  
| RIDADR  | 2845 |  | WGK Germany  | 3 |  | RTECS  | JX3855000 |  | HazardClass  | 4.2 |  | PackingGroup  | I |  
  
 |  | ARACHIDONIC ACID ETHYL ESTER Usage And Synthesis |  
 | Chemical Properties | Clear colorless oil     |  | Uses | Arachidonic acid (AA) is an unsaturated omega-6 fatty acid constituent of the phospholipids of cell membranes. Phospholipase A2 releases AA from the membrane phospholipids in response to inflammation. |  | Uses | Arachidonic Acid ethyl ester is an emollient with healing and smoothing properties that is also reported as appropriate for use in indoor tanning preparations. It is the ester of ethyl alcohol and arachidonic acid. A modified form of ethyl arachidonate can reduce the possibility of irritation that can result from using straight ethyl arachidonate.
 |  | Definition | ChEBI: A long-chain fatty acid ethyl ester resulting from the formal condensation of the carboxy group of arachidonic acid with the hydroxy group of ethanol. |  | Biochem/physiol Actions | Arachidonic acid ethyl ester is a more lipophilic form of arachidonic acid and can be incorporated into dietary regimens or fed to cultured cells as a source of exogenous arachidonate.It is one of the fatty acid ethyl esters that increase cytosolic Ca2+ concentration leading to pancreatic acinar cell injury due to excessive consumption of ethanol.  |  
  
 |  | ARACHIDONIC ACID ETHYL ESTER Preparation Products And Raw materials |  
  |