|
| | 5-(4'-Bromomethyl-1,1'-biphenyl-2-yl)-1-triphenylmethyl-1H-tetrazole Basic information |
| | 5-(4'-Bromomethyl-1,1'-biphenyl-2-yl)-1-triphenylmethyl-1H-tetrazole Chemical Properties |
| Melting point | 152-155°C | | Boiling point | 61°C/12mmHg(lit.) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 0.29±0.10(Predicted) | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C33H25BrN4/c34-24-25-20-22-26(23-21-25)30-18-10-11-19-31(30)32-35-36-37-38(32)33(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-23H,24H2 | | InChIKey | ZTFVTXDWDFIQEU-UHFFFAOYSA-N | | SMILES | N1(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C(C2=CC=CC=C2C2=CC=C(CBr)C=C2)=NN=N1 | | CAS DataBase Reference | 124750-51-2(CAS DataBase Reference) |
| RIDADR | UN 2811 6.1/PG III | | HazardClass | 6.1 | | PackingGroup | III |
| | 5-(4'-Bromomethyl-1,1'-biphenyl-2-yl)-1-triphenylmethyl-1H-tetrazole Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An intermediate in the synthesis of Losartan and Valsartan |
| | 5-(4'-Bromomethyl-1,1'-biphenyl-2-yl)-1-triphenylmethyl-1H-tetrazole Preparation Products And Raw materials |
|