|
| | 2,3,5-TRIFLUOROBENZOIC ACID Basic information |
| Product Name: | 2,3,5-TRIFLUOROBENZOIC ACID | | Synonyms: | 2,3,5-TRIFLUOROBENZOIC ACID;RARECHEM AL BO 0710;2,3,5-Trilfuorobenzoic acid;2,3,5-Trifluorobenzoic acid 98%;2,3,5-Trifluorobenzoicacid98%;2,3,5-Trilfluorobenzoic acid;Benzoic acid, 2,3,5-trifluoro- | | CAS: | 654-87-5 | | MF: | C7H3F3O2 | | MW: | 176.09 | | EINECS: | | | Product Categories: | Miscellaneous | | Mol File: | 654-87-5.mol |  |
| | 2,3,5-TRIFLUOROBENZOIC ACID Chemical Properties |
| Melting point | 109 °C | | Boiling point | 240℃ | | density | 1.536 | | Fp | 99℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 2.59±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C7H3F3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) | | InChIKey | CPZROMDDCPPFOO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=CC(F)=C1F | | CAS DataBase Reference | 654-87-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2916310090 |
| | 2,3,5-TRIFLUOROBENZOIC ACID Usage And Synthesis |
| | 2,3,5-TRIFLUOROBENZOIC ACID Preparation Products And Raw materials |
|
