|
| | 4,4'-Ethylidenebisphenol Basic information |
| Product Name: | 4,4'-Ethylidenebisphenol | | Synonyms: | Ethylidenebisphenol;4,4'-ETHYLIDENEBISPHENOL 99%;4,4'-ETHYLIDENEBISPHENOL 98+%;4,4'-(Methylmethylene)bisphenol;1,1-Bis(4-hydroxyphenyl)ethane
4,4'-Ethylidenediphenol;4,4'-(Ethene-1,1-diyl)diphenol;BISPHENOL E;4,4'-ETHYLIDENEBISPHENOL | | CAS: | 2081-08-5 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | | | Product Categories: | Color Former & Related Compounds;Developer;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 2081-08-5.mol |  |
| | 4,4'-Ethylidenebisphenol Chemical Properties |
| Melting point | 123-127 °C(lit.) | | Boiling point | 215 °C(Press: 0.7 Torr) | | density | 1.171±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.10±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C14H14O2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10,15-16H,1H3 | | InChIKey | HCNHNBLSNVSJTJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2907.19.8000 |
| | 4,4'-Ethylidenebisphenol Usage And Synthesis |
| Uses | Bisphenol E is a derivative of Bisphenol A (B519495) which is a monomer used for polycarbonate and epoxy resins. It is used to stabilize formulations and improve the oil retention capacity. | | Definition | ChEBI: 1,1-Bis(4-hydroxyphenyl)ethane is a diarylmethane. | | Synthesis | 4,4'-Ethylidenebisphenol is prepared by reacting Phenol with 4-Hydroxystyrene refluxed for 4h in prestence of Iron chloride.
 |
| | 4,4'-Ethylidenebisphenol Preparation Products And Raw materials |
|
