|
| | PERFLUOROTRI-N-BUTYLAMINE Basic information |
| | PERFLUOROTRI-N-BUTYLAMINE Chemical Properties |
| Melting point | -52 °C | | Boiling point | 97 °C | | density | 1.883 g/mL at 25 °C(lit.) | | vapor density | 23.3 (vs air) | | vapor pressure | 1.3 mm Hg ( 25 °C) | | refractive index | n20/D 1.3 | | Fp | None | | storage temp. | 2-8°C | | form | liquid | | InChI | InChI=1S/C12F27N/c13-1(14,7(25,26)27)4(19,20)10(34,35)40(11(36,37)5(21,22)2(15,16)8(28,29)30)12(38,39)6(23,24)3(17,18)9(31,32)33 | | InChIKey | RVZRBWKZFJCCIB-UHFFFAOYSA-N | | SMILES | N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Perfluoro compounds, C5-18 (86508-42-1) |
| | PERFLUOROTRI-N-BUTYLAMINE Usage And Synthesis |
| Definition | PERFLUOROTRI-N-BUTYLAMINE is an inert fluid composed of a complex combination of organic compounds resulting from the distillation of electrochemically fluorinated organic compounds. It consists of branched, linear, and cyclic perfluorinated hydrocarbons having carbon numbers predominantly in the range of C5-C18 and boiling in the range of approximately 25.degree.C to 255.degree.C (77.degree.F to 491.degree.F). Perfluorinated amine and ether compounds may also be present. |
| | PERFLUOROTRI-N-BUTYLAMINE Preparation Products And Raw materials |
|