|
| | Cholesteryl chloride Basic information |
| Product Name: | Cholesteryl chloride | | Synonyms: | CHOLESTERYL CHLORIDE 98%;CHOLESTERYL CHLORIDE(REAGENT / STANDARD GRADE);Cholesterylchloride,98%;3-b-Chlorocholest-5-ene.;CHOLESTERYLBETA-CHLORIDE;CHOLESTERYLCHLORIDE(CHOLESTEROLCHLORIDE);Cholest-5-ene, 3-chloro-, (3b)-;Cholesteryl Chloride from Beef Fat | | CAS: | 910-31-6 | | MF: | C27H45Cl | | MW: | 405.1 | | EINECS: | 213-004-4 | | Product Categories: | Steroids;Organics | | Mol File: | 910-31-6.mol |  |
| | Cholesteryl chloride Chemical Properties |
| Melting point | 94-96 °C (lit.) | | alpha | -30 º (c=1, chloroform) | | Boiling point | 488.29°C (rough estimate) | | density | 0.9160 (rough estimate) | | refractive index | 1.6281 (estimate) | | storage temp. | Store below +30°C. | | optical activity | [α]25/D 24°, c = 1 in chloroform | | BRN | 2703655 | | InChIKey | OTVRYZXVVMZHHW-DPAQBDIFSA-N | | SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](Cl)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,29,r| | | LogP | 11.576 (est) | | CAS DataBase Reference | 910-31-6(CAS DataBase Reference) | | NIST Chemistry Reference | Cholest-5-ene, 3beta-chloro(910-31-6) | | EPA Substance Registry System | Cholest-5-ene, 3-chloro-, (3.beta.)- (910-31-6) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29035990 |
| | Cholesteryl chloride Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder |
| | Cholesteryl chloride Preparation Products And Raw materials |
|