|
| | 2-Fluorobenzoic acid Basic information |
| | 2-Fluorobenzoic acid Chemical Properties |
| Melting point | 122-125 °C (lit.) | | Boiling point | 114 °C | | density | 1,46 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | solubility | 7.2g/l | | pka | 3.27(at 25℃) | | form | Crystalline Powder or Needles | | color | White to light yellow | | Water Solubility | Slightly soluble in water. | | BRN | 971265 | | InChI | InChI=1S/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) | | InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1F | | CAS DataBase Reference | 445-29-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2-fluoro-(445-29-4) | | EPA Substance Registry System | Benzoic acid, 2-fluoro- (445-29-4) |
| | 2-Fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder. soluble in organic solvents such as benzene, toluene, ketone and ether.The corresponding 2-fluorobenzoyl chloride can be obtained by reacting 2-fluorobenzoic acid with an acid chloride agent such as SOCl2, PCl3, etc. | | Uses | 2-Fluorobenzoic acid is an intermediate of the fungicide tritriazole and meclofenamic acid. | | Uses | 2-Fluorobenzoic acid may be employed in the preparation of zaragozic acid A analogs. It is also used as an organic chemical synthesis intermediate. | | Preparation | The preparation of 2-fluorobenzoic acid is based on anthranilic acid as raw material, adding anhydrous hydrogen fluoride and sodium nitrite in methoxyethyl methyl ether solvent for diazotization, refluxing for 3 hours, and post-processing to obtain the finished product. | | Definition | ChEBI: 2-fluorobenzoic acid is a 2-halobenzoic acid that is benzoic acid carrying a fluoro substituent at position 2. It is a fluorobenzoic acid and a 2-halobenzoic acid. It is a conjugate acid of a 2-fluorobenzoate. | | Purification Methods | Crystallise the acid from 50% aqueous EtOH, dilute HCl or *C6H6, then purify it by zone melting or vacuum sublimation at 130-140o. [Beilstein 9 H 333. 9 III 1324, 9 IV 950.] |
| | 2-Fluorobenzoic acid Preparation Products And Raw materials |
|