|
| | anemonin Basic information |
| Product Name: | anemonin | | Synonyms: | Pulsatilla camphor;1,7-dioxadispiro[4.0.4^{6}.2^{5}]dodeca-3,9-diene-2,8-dione;1,7-dioxadispiro[4.0.4^{6}.2^{5}]dodeca-3,9-diene-2,8-quinone;ANEMONIN(P);(5R,6R)-rel-1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione;(5R,6R)-4,7-dioxadispiro[4.0.4^{6}.2^{5}]dodeca-1,9-diene-3,8-dione;1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione, (5R,6R)-rel-;Anemonin/Pulsatilla camphor | | CAS: | 508-44-1 | | MF: | C10H8O4 | | MW: | 192.17 | | EINECS: | | | Product Categories: | | | Mol File: | 508-44-1.mol |  |
| | anemonin Chemical Properties |
| Melting point | 157-158℃ | | Boiling point | 248.14°C (rough estimate) | | density | 1.45 | | refractive index | 1.4440 (estimate) | | InChI | InChI=1/C10H8O4/c11-7-1-3-9(13-7)5-6-10(9)4-2-8(12)14-10/h1-4H,5-6H2/t9-,10-/s3 | | InChIKey | JLUQTCXCAFSSLD-DPIMBTEZNA-N | | SMILES | O1[C@]2(CC[C@]32C=CC(=O)O3)C=CC1=O |&1:1,4,r| |
| Toxicity | LD50 i.p. in mice: 150 mg/kg (Brodersen, Kjaer) |
| | anemonin Usage And Synthesis |
| Uses | Anemonin is a Chinese herbal medicinal ingredient that inhibits pigmentation synthesis in human melanocytes. | | Biological Activity | Anemonin is the dimerization product of the toxin protoanemonin and easily reacts with water to a dicarboxylic acid. | | Physiological effects | Anemonin have the effect of antispasmodic and analgesic. |
| | anemonin Preparation Products And Raw materials |
|
