|
| | Pralmorelin Basic information |
| Product Name: | Pralmorelin | | Synonyms: | d-ala-β-(2-naphthyl)-d-ala-trp-d-phe-lys amide;L-Lysinamide, D-alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-;PRALMORELIN;D-ALA-D-NAL(2)-ALA-TRP-D-PHE-LYS-NH2 ACETATE SALT;D-ALA-BETA-(2-NAPHTHYL)-D-ALA-TRP-D-PHE-LYS AMIDE;D-ALA-D-2-NAL-ALA-TRP-D-PHE-LYS-NH2;(DES-ALA3,D-ALA1,D-2-NAL2)-GHRP-6;(DES-ALA3)-GHRP-2 | | CAS: | 158861-67-7 | | MF: | C45H55N9O6 | | MW: | 817.97 | | EINECS: | 206-616-8 | | Product Categories: | Peptide;Peptides;GHRP2;hgh;158861-67-7 | | Mol File: | 158861-67-7.mol |  |
| | Pralmorelin Chemical Properties |
| Melting point | 149 - 151°C | | Boiling point | 1265.3±65.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly, Sonicated), Water (Slightly) | | form | lyophilized powder | | pka | 13.40±0.46(Predicted) | | color | white to beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C45H55N9O6/c1-27(47)41(56)52-38(24-30-19-20-31-14-6-7-15-32(31)22-30)43(58)50-28(2)42(57)53-39(25-33-26-49-35-17-9-8-16-34(33)35)45(60)54-37(23-29-12-4-3-5-13-29)44(59)51-36(40(48)55)18-10-11-21-46/h3-9,12-17,19-20,22,26-28,36-39,49H,10-11,18,21,23-25,46-47H2,1-2H3,(H2,48,55)(H,50,58)(H,51,59)(H,52,56)(H,53,57)(H,54,60)/t27-,28+,36+,37-,38-,39+/m1/s1 | | InChIKey | HRNLPPBUBKMZMT-RDRUQFPZSA-N | | SMILES | C(N)(=O)[C@H](CCCCN)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](C)NC(=O)[C@@H](CC1=CC=C2C(=C1)C=CC=C2)NC(=O)[C@@H](C)N | | CAS DataBase Reference | 158861-67-7(CAS DataBase Reference) |
| | Pralmorelin Usage And Synthesis |
| Description | Pralmorelin (also known as KP-102, GPA-748, GHRP-2) is a potent GH secretagogue in development as a diagnostic agent for growth hormone deficiency and for the treatment of pituitary disorders and GH deficiency. It acts as a Signal molecules that are involved in the control of cell growth and differentiation. | | Uses | Growth hormone releasing factor. Pralmorelin is a growth hormone secretagogue that acts on the pituitary gland and the hypothalamus to stimulate and amplify pulsatile growth hormone release. | | Definition | ChEBI: Pralmorelin is an oligopeptide. | | benefits | Regulation of blood pressure, increased strength and healing, reduced injury, increased cell rejuvenation, increase in lean muscle mass and stronger bones.
| | Biochem/physiol Actions | Pralmorelin, also known as Growth hormone-releasing peptide 2 or GHRP-2, is an orally-active, synthetic peptide analogue of met-enkephalin that acts as a ghrelin/growth hormone secretagogue receptor (GHSR) agonist to selectively stimulate the ghrelin receptor and cause growth hormone release. Pralmorelin (GHRP-2) has been used clinically for the assessment of growth hormone deficiency (GHD), It has also been shown to have anti-inflammatory activity. |
| | Pralmorelin Preparation Products And Raw materials |
|
