| 
 |  | 2,4-Dihydroxybenzamide Basic information |  
  
 |  | 2,4-Dihydroxybenzamide Chemical Properties |  
 | Melting point  | 228 °C |  | Boiling point  | 455.8±15.0 °C(Predicted) |  | density  | 1.458±0.06 g/cm3(Predicted) |  | storage temp.  | Sealed in dry,Room Temperature |  | solubility  | soluble in Methanol |  | pka | 8.15±0.10(Predicted) |  | form  | powder to crystal |  | color  | White to Light red to Green |  | InChI | InChI=1S/C7H7NO3/c8-7(11)5-2-1-4(9)3-6(5)10/h1-3,9-10H,(H2,8,11) |  | InChIKey | IIUJCQYKTGNRHH-UHFFFAOYSA-N |  | SMILES | C(N)(=O)C1=CC=C(O)C=C1O |  | CAS DataBase Reference | 3147-45-3(CAS DataBase Reference) |  | EPA Substance Registry System | Benzamide, 2,4-dihydroxy- (3147-45-3) |  
  
 |  | 2,4-Dihydroxybenzamide Usage And Synthesis |  
 | Uses | 2,4-Dihydroxybenzamide is a specific inhibitor of glutathione reductase. |  
  
 |  | 2,4-Dihydroxybenzamide Preparation Products And Raw materials |  
  
 
 |