|
| | 4-BROMO-2,3,5,6-TETRAFLUOROANILINE Basic information |
| Product Name: | 4-BROMO-2,3,5,6-TETRAFLUOROANILINE | | Synonyms: | 4-BROMOTETRAFLUOROANILINE;4-BROMO-2,3,5,6-TETRAFLUOROANILINE;4-Bromo-2,3,5,6-tetrafluoroaniline 98%;4-Bromo-2,3,5,6-tetrafluoroaniline98%;4-Bromo-2,3,5,6-tetrafluoraniline, 98%;2,3,5,6-Tetrafluoro-4-bromoaniline;4-bromo-N,N,2,3-tetrafluoroaniline;Benzenamine, 4-bromo-2,3,5,6-tetrafluoro- | | CAS: | 1998-66-9 | | MF: | C6H2BrF4N | | MW: | 243.98 | | EINECS: | | | Product Categories: | Amines;C2 to C6;Nitrogen Compounds | | Mol File: | 1998-66-9.mol |  |
| | 4-BROMO-2,3,5,6-TETRAFLUOROANILINE Chemical Properties |
| Melting point | 59-61 °C (lit.) | | Boiling point | 104-106 °C(Press: 15 Torr) | | density | 1.955±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -0.92±0.10(Predicted) | | form | solid | | color | Pale beige | | InChI | InChI=1S/C6H2BrF4N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 | | InChIKey | LZUYSMHNMFCPBF-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C(F)=C(Br)C(F)=C1F | | CAS DataBase Reference | 1998-66-9(CAS DataBase Reference) |
| | 4-BROMO-2,3,5,6-TETRAFLUOROANILINE Usage And Synthesis |
| General Description | The decomposition of 4-bromo-2,3,5,6-tetrafluoroaniline by pentyl nitrite yields the corresponding aryl radicals. |
| | 4-BROMO-2,3,5,6-TETRAFLUOROANILINE Preparation Products And Raw materials |
|