|
| | ETONITAZEPYNE Basic information |
| Product Name: | ETONITAZEPYNE | | Synonyms: | 1H-Benzimidazole, 2-[(4-ethoxyphenyl)methyl]-5-nitro-1-[2-(1-pyrrolidinyl)ethyl]-;N-Pyrrolidino Etonitazene;ETONITAZEPYNE | | CAS: | 2785346-75-8 | | MF: | C22H26N4O3 | | MW: | 394.47 | | EINECS: | 606-227-7 | | Product Categories: | | | Mol File: | 2785346-75-8.mol |  |
| | ETONITAZEPYNE Chemical Properties |
| Boiling point | 608.6±50.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetonitrile: 10 mg/ml DMF: 30 mg/ml DMSO: 1 mg/ml Ethanol: 5 mg/ml Methanol: 10 mg/ml | | pka | 9.90±0.20(Predicted) | | form | A crystalline solid | | λmax | 242 nm | | InChI | InChI=1S/C22H26N4O3/c1-2-29-19-8-5-17(6-9-19)15-22-23-20-16-18(26(27)28)7-10-21(20)25(22)14-13-24-11-3-4-12-24/h5-10,16H,2-4,11-15H2,1H3 | | InChIKey | LQZWZCJCEPUKCJ-UHFFFAOYSA-N | | SMILES | C1(CC2=CC=C(OCC)C=C2)N(CCN2CCCC2)C2=CC=C([N+]([O-])=O)C=C2N=1 |
| | ETONITAZEPYNE Usage And Synthesis |
| | ETONITAZEPYNE Preparation Products And Raw materials |
|