|
| Product Name: | Kavain | | Synonyms: | TRANS-5,6-DIHYDRO-4-METHOXY-6-(2-PHENYLETHENYL)-2H-PYRAN-2-ONE;DL-KAVAIN;DL-KAWAIN;KAWAIN;KAVAIN, DL-;DL-Kawain, trans-5,6-Dihydro-4-methoxy-6-(2-phenylethenyl)-2H-pyran-2-one;Kavain，DL-Kavain;2H-Pyran-2-one, 5,6-dihydro-4-methoxy-6-(2-phenylethenyl)-, (E)-(+-)- | | CAS: | 3155-48-4 | | MF: | C14H14O3 | | MW: | 230.26 | | EINECS: | | | Product Categories: | | | Mol File: | 3155-48-4.mol |  |
| | Kavain Chemical Properties |
| Melting point | 142-148 °C | | Boiling point | 432.6±45.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | neat | | color | Off-White to Pale Yellow | | BRN | 177877 | | Stability: | Light and Moisture Sensitive | | InChI | InChI=1S/C14H14O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+ | | InChIKey | XEAQIWGXBXCYFX-BQYQJAHWSA-N | | SMILES | C1(=O)OC(/C=C/C2=CC=CC=C2)CC(OC)=C1 | | LogP | 1.690 (est) | | CAS DataBase Reference | 3155-48-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | F | 10-23 |
| | Kavain Usage And Synthesis |
| Uses | anticonvulsant, analgesic, anxiolytic, suppreses excitatory postsynaptic potential | | Uses | rac-Kavain is the main kavalactone found in the roots of the kava plant. Kavain is known to exhibit anticonvulsive properties by attenuating vascular smooth muscle contraction through interactions with voltage-dependent sodium and calcium channels. rac-Kavain was shown in recent research to exhibit protective properties on anaerobic glycolysis, ATP content and intracellular calcium and sodium of anoxic brain vesicles. | | Definition | ChEBI: DL-kavain is https://www.chemicalbook.com/ProductChemicalPropertiesCB9738874_EN.htm It has a role as a glycine receptor antagonist. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 41, p. 4070, 1976 DOI: 10.1021/jo00888a004 |
| | Kavain Preparation Products And Raw materials |
|
