|  | |  |  | N,N,N-Trimethyl-1-ammonium adamantane Basic information | 
 | Product Name: | N,N,N-Trimethyl-1-ammonium adamantane |  | Synonyms: | N,N,N-Trimethyl-1-ammonium adamantane;1-Adamantyltrimethylammonium hydroxide;N,N,N-Trimethyl-1-;N,N,N-Trimethyl-1-adamantammonium hydroxide;Tricyclo[3.3.1.13,7]decan-1-aMiniuM, N,N,N-triMethyl-, hydroxide;N,N,N-TriMethyl-1-AdaMantyl AMMoniuM Hydroxide;N,N,N-Trimethyladamantan-1-aminium hydroxide;1-Adamantyltrimethylammonium hydroxide   N,N,N-Trimethyl-1-ammonium adamantane |  | CAS: | 53075-09-5 |  | MF: | C13H25NO |  | MW: | 211.35 |  | EINECS: | 610-954-5 |  | Product Categories: |  |  | Mol File: | 53075-09-5.mol |  |  | 
|  |  | N,N,N-Trimethyl-1-ammonium adamantane Chemical Properties | 
 | Boiling point | 101.4℃ at 101.325kPa |  | density | 1.032 at 20℃ |  | vapor pressure | 22.4-117.5hPa at 20-50℃ |  | storage temp. | 2-8°C |  | form | clear liquid |  | color | Colorless to Almost colorless |  | InChI | InChI=1S/C13H24N.H2O/c1-14(2,3)13-7-10-4-11(8-13)6-12(5-10)9-13;/h10-12H,4-9H2,1-3H3;1H2/q+1;/p-1 |  | InChIKey | GNUJKXOGRSTACR-UHFFFAOYSA-M |  | SMILES | [N+](C12CC3CC(CC(C3)C1)C2)(C)(C)C.[OH-] |  | LogP | -2 at 23℃ and pH11.7 | 
|  |  | N,N,N-Trimethyl-1-ammonium adamantane Usage And Synthesis | 
|  |  | N,N,N-Trimethyl-1-ammonium adamantane Preparation Products And Raw materials | 
 |