|
| | N,N,N-Trimethyl-1-ammonium adamantane Basic information |
| Product Name: | N,N,N-Trimethyl-1-ammonium adamantane | | Synonyms: | N,N,N-Trimethyl-1-ammonium adamantane;1-Adamantyltrimethylammonium hydroxide;N,N,N-Trimethyl-1-;N,N,N-Trimethyl-1-adamantammonium hydroxide;Tricyclo[3.3.1.13,7]decan-1-aMiniuM, N,N,N-triMethyl-, hydroxide;N,N,N-TriMethyl-1-AdaMantyl AMMoniuM Hydroxide;N,N,N-Trimethyladamantan-1-aminium hydroxide;1-Adamantyltrimethylammonium hydroxide N,N,N-Trimethyl-1-ammonium adamantane | | CAS: | 53075-09-5 | | MF: | C13H25NO | | MW: | 211.35 | | EINECS: | 610-954-5 | | Product Categories: | | | Mol File: | 53075-09-5.mol |  |
| | N,N,N-Trimethyl-1-ammonium adamantane Chemical Properties |
| Boiling point | 101.4℃ at 101.325kPa | | density | 1.032 at 20℃ | | vapor pressure | 22.4-117.5hPa at 20-50℃ | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C13H24N.H2O/c1-14(2,3)13-7-10-4-11(8-13)6-12(5-10)9-13;/h10-12H,4-9H2,1-3H3;1H2/q+1;/p-1 | | InChIKey | GNUJKXOGRSTACR-UHFFFAOYSA-M | | SMILES | [N+](C12CC3CC(CC(C3)C1)C2)(C)(C)C.[OH-] | | LogP | -2 at 23℃ and pH11.7 |
| | N,N,N-Trimethyl-1-ammonium adamantane Usage And Synthesis |
| | N,N,N-Trimethyl-1-ammonium adamantane Preparation Products And Raw materials |
|
