|
| | 2,4,5-Trifluorobenzaldehyde Basic information |
| Product Name: | 2,4,5-Trifluorobenzaldehyde | | Synonyms: | 2,4,5-Trifluorobenzaldehyde 97%;2,4,5-Trifluorobenzaldehyde97%;2,4,5-trifluorobenzadehyde;Sitagliptin-15;Benzaldehyde,2,4,5-trifluoro-;2,4,5-Trifluorobenzaldehyde, 97% 1GR;2,4,5-TRIFLUOROBENZALDEHYDE;2,4,5-Trilfuorobenzaldehyde | | CAS: | 165047-24-5 | | MF: | C7H3F3O | | MW: | 160.09 | | EINECS: | 605-382-8 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);ALDEHYDE;HALIDE;Benzaldehyde;Miscellaneous;Fluorine series;Aldehydes;C7;Carbonyl Compounds | | Mol File: | 165047-24-5.mol |  |
| | 2,4,5-Trifluorobenzaldehyde Chemical Properties |
| Boiling point | 168 °C (lit.) | | density | 1.408 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.482(lit.) | | Fp | 137 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | Specific Gravity | 1.408 | | color | Clear colorless to light yellow | | Water Solubility | Not miscible or difficult to mix in water. | | Sensitive | Air Sensitive | | BRN | 8479631 | | InChI | InChI=1S/C7H3F3O/c8-5-2-7(10)6(9)1-4(5)3-11/h1-3H | | InChIKey | CYIFJRXFYSUBFW-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(F)=C(F)C=C1F | | CAS DataBase Reference | 165047-24-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 1 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29130000 |
| | 2,4,5-Trifluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid | | Uses | It is a reactant in the enantioselective synthesis of (R)-selegiline, an anti-Parkinson's drug, (S)-benzphetamine, an anti-obesity agent, and (S)-sitagliptin, an anti-diabetic drug. | | Uses | 2,4,5-Trifluorobenzaldehyde may be used in the synthesis of:
- bis(2,4,5-trifluorophenyl)methanone
- 8-phenyl-7-tosyl-1-(2,4,5-trifluorophenyl)octahydro-1H-pyrano[3,4-c] pyridine
- (E)-4-methoxy-N′-(2,4,5-trifluorobenzylidene)-benzohydrazide monohydrate
|
| | 2,4,5-Trifluorobenzaldehyde Preparation Products And Raw materials |
|