|
| | LCZ696 InteMediate Basic information |
| Product Name: | LCZ696 InteMediate | | Synonyms: | N-[(1R)-2-[1,1'-Biphenyl]-4-yl-1-(hydroxymethyl)ethyl]carbamic acid 1,1-dimethylethyl ester;LCZ696 InteMediate;(R)-tert-butyl (1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbaMate;LCZ696(valsartan + sacubitril) impurity 29;(R) -tert-butyl (1-([1,1'-biphenyl] -4-yl) -3-hydroxypropane-2-yl) carbamate;(R)-tert-butyl (1-([1;1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate;tert-butyl (R)-(1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate | | CAS: | 1426129-50-1 | | MF: | C20H25NO3 | | MW: | 327.42 | | EINECS: | 202-804-9 | | Product Categories: | LCZ696;LCZ 696;1426129-50-1 | | Mol File: | 1426129-50-1.mol |  |
| | LCZ696 InteMediate Chemical Properties |
| Boiling point | 514.5±50.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.85±0.46(Predicted) | | InChI | InChI=1S/C20H25NO3/c1-20(2,3)24-19(23)21-18(14-22)13-15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,18,22H,13-14H2,1-3H3,(H,21,23)/t18-/m1/s1 | | InChIKey | TYQICOFAZDVKMK-GOSISDBHSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H](CO)CC1=CC=C(C2=CC=CC=C2)C=C1 |
| | LCZ696 InteMediate Usage And Synthesis |
| Uses | N-?[(1R)?-?2-?[1,?1''-?Biphenyl]?-?4-?yl-?1-?(hydroxymethyl)?ethyl]?-carbamic Acid 1,?1-?Dimethylethyl Ester is a useful intermediate for preparing Sacubitril (S080900)/Valsartan (V095750). |
| | LCZ696 InteMediate Preparation Products And Raw materials |
|