|  | |  |  | 2-Amino-5-cyanopyridine Basic information | 
|  |  | 2-Amino-5-cyanopyridine Chemical Properties | 
 | Melting point | 159-163 °C(lit.) |  | Boiling point | 240-250°C 15mm |  | density | 1.23±0.1 g/cm3(Predicted) |  | Fp | 240-250°C/15mm |  | storage temp. | Keep in dark place,Sealed in dry,Room Temperature |  | form | Crystalline Powder |  | pka | 3.48±0.13(Predicted) |  | color | Brown |  | Water Solubility | Soluble in methanol. Insoluble in water. |  | BRN | 113876 |  | InChI | InChI=1S/C6H5N3/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,(H2,8,9) |  | InChIKey | KDVBYUUGYXUXNL-UHFFFAOYSA-N |  | SMILES | C1=NC(N)=CC=C1C#N |  | CAS DataBase Reference | 4214-73-7(CAS DataBase Reference) | 
| Hazard Codes | Xn,Xi |  | Risk Statements | 20/21/22-36/37/38 |  | Safety Statements | 36-26 |  | RIDADR | UN 2811 6.1/PG 3 |  | WGK Germany | 3 |  | F | 10-23 |  | Hazard Note | Irritant |  | HazardClass | 6.1 |  | PackingGroup | III |  | HS Code | 29333990 | 
|  |  | 2-Amino-5-cyanopyridine Usage And Synthesis | 
 | Chemical Properties | brown crystalline powder |  | Uses | 2-Amino-5-cyanopyridine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | 
|  |  | 2-Amino-5-cyanopyridine Preparation Products And Raw materials | 
 |