|
| | 2-Amino-5-cyanopyridine Basic information |
| | 2-Amino-5-cyanopyridine Chemical Properties |
| Melting point | 159-163 °C(lit.) | | Boiling point | 240-250°C 15mm | | density | 1.23±0.1 g/cm3(Predicted) | | Fp | 240-250°C/15mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 3.48±0.13(Predicted) | | color | Brown | | Water Solubility | Soluble in methanol. Insoluble in water. | | BRN | 113876 | | InChI | InChI=1S/C6H5N3/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,(H2,8,9) | | InChIKey | KDVBYUUGYXUXNL-UHFFFAOYSA-N | | SMILES | C1=NC(N)=CC=C1C#N | | CAS DataBase Reference | 4214-73-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-26 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 |
| | 2-Amino-5-cyanopyridine Usage And Synthesis |
| Chemical Properties | brown crystalline powder | | Uses | 2-Amino-5-cyanopyridine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | 2-Amino-5-cyanopyridine Preparation Products And Raw materials |
|