|  | |  |  | N-BOC-4-Hydroxypiperidine Basic information | 
|  |  | N-BOC-4-Hydroxypiperidine Chemical Properties | 
 | Melting point | 61-65 °C (lit.) |  | Boiling point | 292.3±33.0 °C(Predicted) |  | density | 1.107±0.06 g/cm3(Predicted) |  | storage temp. | Keep in dark place,Sealed in dry,Room Temperature |  | solubility | Chloroform, Ethyl Acetate |  | pka | 14.80±0.20(Predicted) |  | form | Powder |  | color | White to cream |  | BRN | 7202094 |  | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h8,12H,4-7H2,1-3H3 |  | InChIKey | PWQLFIKTGRINFF-UHFFFAOYSA-N |  | SMILES | N1(C(OC(C)(C)C)=O)CCC(O)CC1 |  | CAS DataBase Reference | 109384-19-2(CAS DataBase Reference) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 26-36-37/39 |  | WGK Germany | 3 |  | HazardClass | IRRITANT |  | HS Code | 29339900 | 
|  |  | N-BOC-4-Hydroxypiperidine Usage And Synthesis | 
 | Chemical Properties | White to cream powder |  | Uses | N-Boc-4-hydroxypiperidine is a 4-hydroxypyridine with a boc protecting group used in the preparation of neurologically active agents and other pharmaceutical compounds. |  | Uses | Used in a synthesis of N-heterocyclic alkyl ethers via the Mitsunobu reaction. | 
|  |  | N-BOC-4-Hydroxypiperidine Preparation Products And Raw materials | 
 |