|
| | N-BOC-4-Hydroxypiperidine Basic information |
| | N-BOC-4-Hydroxypiperidine Chemical Properties |
| Melting point | 61-65 °C (lit.) | | Boiling point | 292.3±33.0 °C(Predicted) | | density | 1.107±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | pka | 14.80±0.20(Predicted) | | form | Powder | | color | White to cream | | BRN | 7202094 | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h8,12H,4-7H2,1-3H3 | | InChIKey | PWQLFIKTGRINFF-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(O)CC1 | | CAS DataBase Reference | 109384-19-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | N-BOC-4-Hydroxypiperidine Usage And Synthesis |
| Chemical Properties | White to cream powder | | Uses | N-Boc-4-hydroxypiperidine is a 4-hydroxypyridine with a boc protecting group used in the preparation of neurologically active agents and other pharmaceutical compounds. | | Uses | Used in a synthesis of N-heterocyclic alkyl ethers via the Mitsunobu reaction. |
| | N-BOC-4-Hydroxypiperidine Preparation Products And Raw materials |
|