|
| | Pentafluorobenzaldehyde Basic information |
| Product Name: | Pentafluorobenzaldehyde | | Synonyms: | Benzaldehyde, 2,3,4,5,6-pentafluoro-;Benzaldehyde, pentafluoro-;PERFLUOROBENZALDEHYDE;PENTAFLUOROBENZALDEHYDE;2,3,4,5,6-PENTAFLUOROBENZALDEHYDE;Pentafluorobenzaldehyde, 98+%;Pentafluorobenzaldehyde 98%;PENTAFLUOROBENZALDEHYDE , COLORLESS SOLID | | CAS: | 653-37-2 | | MF: | C7HF5O | | MW: | 196.07 | | EINECS: | 211-502-6 | | Product Categories: | organofluorine compounds;Aldehydes;Aromatic Aldehydes & Derivatives (substituted);Benzaldehyde;C7;Carbonyl Compounds | | Mol File: | 653-37-2.mol |  |
| | Pentafluorobenzaldehyde Chemical Properties |
| Melting point | 24-28 °C(lit.) | | Boiling point | 164-166 °C(lit.) | | density | 1.588 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.45(lit.) | | Fp | 172 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid After Melting | | color | Clear yellow | | Specific Gravity | 1.588 | | Water Solubility | Sparingly Soluble in water (0.027 g/L at 25°C). | | Sensitive | Air Sensitive | | BRN | 1876550 | | InChI | InChI=1S/C7HF5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h1H | | InChIKey | QJXCFMJTJYCLFG-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 653-37-2(CAS DataBase Reference) |
| Hazard Codes | Xn,F,Xi | | Risk Statements | 20/22-36/37/38-20 | | Safety Statements | 26-37/39 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | RTECS | CU7542000 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29130000 |
| | Pentafluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | Freshly distilled pentafluorobenzaldehyde is a colourless liquid with a strong odour; clear yellowish liquid after melting; a lachrymator; soluble in common organic solvents and practically insoluble in water. | | Uses | Pentafluorobenzaldehyde was used as derivatization reagent in a study to develop a sensitive method for the determination of primary amines in sewage sludge by headspace solid-phase micro extraction and gas chromatography-tandem mass spectrometry. It was used in the synthesis of novel, high molecular weight fluorinated aromatic polymers. | | Preparation | Pentafluorobenzaldehyde is prepared by the reaction ofpentafluorophenylmagnesium bromide, iodide or chloride, or of pentafluorophenyllithium with ethyl-ortho-formiate or 3,4-dihydro-6-methyl-3-(para-tolyl)-quinazoline methiodide. Higher yields of pentafluorobenza1dehyde have been obtained by the reaction with N-methy1formanilide. Pentafluorobenzaldehyde may be prepared also by the reaction of pentafluorobenzonitrile with anhydrous SnClz in ethereal solution of HCl with subsequent hydrolsis of the intermediate (62% yield). | | General Description | 2,3,4,5,6-Pentafluorobenzaldehyde reacts with 5-(aryl)dipyrromethanes to form a variety of meso-aryl [26]hexaphyrins. | | Precautions | Pentafluorobenzaldehyde is oxidized when exposed to light and air. It should be kept in a tightly stopped dark container. Pentafluorobenzaldehyde is about ten times as toxic as benzaldehyde, therefore it should be handled with caution. |
| | Pentafluorobenzaldehyde Preparation Products And Raw materials |
|
