|  | |  |  | MMB-2201 Basic information | 
|  |  | MMB-2201 Chemical Properties | 
 | Boiling point | 552.9±40.0 °C(Predicted) |  | density | 1.15±0.1 g/cm3(Predicted) |  | pka | 13.16±0.46(Predicted) |  | InChI | InChI=1S/C20H27FN2O3/c1-14(2)18(20(25)26-3)22-19(24)16-13-23(12-8-4-7-11-21)17-10-6-5-9-15(16)17/h5-6,9-10,13-14,18H,4,7-8,11-12H2,1-3H3,(H,22,24)/t18-/m0/s1 |  | InChIKey | JFXASAFVUQVGEW-SFHVURJKSA-N |  | SMILES | C(OC)(=O)[C@H](C(C)C)NC(C1C2=C(N(CCCCCF)C=1)C=CC=C2)=O | 
|  |  | MMB-2201 Usage And Synthesis | 
 | Uses | MMB2201 is a synthetic cannabinoid that combines methyl valinate with the 1-(5-fluoropentyl)-indole-3-keto subgroup of AM2201.Synthetic Cannabinoids |  | Application | I-AMB is an analog of 5-fluoro AMB that was developed on an indole base instead of the indazole base typically associated with AB-PINACA. | 
|  |  | MMB-2201 Preparation Products And Raw materials | 
 |