|
| | MMB-2201 Basic information |
| | MMB-2201 Chemical Properties |
| Boiling point | 552.9±40.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | pka | 13.16±0.46(Predicted) | | InChI | InChI=1S/C20H27FN2O3/c1-14(2)18(20(25)26-3)22-19(24)16-13-23(12-8-4-7-11-21)17-10-6-5-9-15(16)17/h5-6,9-10,13-14,18H,4,7-8,11-12H2,1-3H3,(H,22,24)/t18-/m0/s1 | | InChIKey | JFXASAFVUQVGEW-SFHVURJKSA-N | | SMILES | C(OC)(=O)[C@H](C(C)C)NC(C1C2=C(N(CCCCCF)C=1)C=CC=C2)=O |
| | MMB-2201 Usage And Synthesis |
| Uses | MMB2201 is a synthetic cannabinoid that combines methyl valinate with the 1-(5-fluoropentyl)-indole-3-keto subgroup of AM2201.Synthetic Cannabinoids | | Application | I-AMB is an analog of 5-fluoro AMB that was developed on an indole base instead of the indazole base typically associated with AB-PINACA. |
| | MMB-2201 Preparation Products And Raw materials |
|