|
| | DL-TROPIC ACID Basic information |
| Product Name: | DL-TROPIC ACID | | Synonyms: | dl-tropic;A-PHENYL-B-HYDROXYPROPIONIC ACID;DL-TROPIC ACID;DL-A-PHENYLHYDRACRYLIC ACID;TROPIC ACID, DL-;Hyoscine Butylbromide EP Impurity B;Hyoscine Butylbromide Impurity 2（Hyoscine Butylbromide EP Impurity B）;Ipratropium EP Impurity C | | CAS: | 552-63-6 | | MF: | C9H10O3 | | MW: | 166.18 | | EINECS: | 209-020-6 | | Product Categories: | | | Mol File: | 552-63-6.mol |  |
| | DL-TROPIC ACID Chemical Properties |
| Melting point | 116-118 °C(lit.) | | Boiling point | 322.5±30.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 0.1 g/mL, clear | | pka | pKa 3.38(H2O
t = 25
c = 0.03–0.001) (Uncertain) | | form | Solid | | color | White to Off-White | | Water Solubility | Soluble in water (20 g/L) at 20°C, ethanol, ether, alcohol, and methanol (0.1 g/ml). | | Merck | 14,9779 | | BRN | 2209199 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) | | InChIKey | JACRWUWPXAESPB-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(CO)C(=O)O | | LogP | 0.280 (est) | | EPA Substance Registry System | Tropic acid (552-63-6) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | CY8535000 | | TSCA | Yes | | HS Code | 2918195000 |
| | DL-TROPIC ACID Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | Tropic Acid (Ipratropium EP Impurity C) is a benzoic acid derivative and thus carries anti-fungal properties. | | Definition | ChEBI: A 3-hydroxy monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a phenyl group, and one of the methyl hydrogens is substituted by a hydroxy group. |
| | DL-TROPIC ACID Preparation Products And Raw materials |
|
