|
| | 5-Bromo-4,6-dimethoxypyrimidine Basic information |
| Product Name: | 5-Bromo-4,6-dimethoxypyrimidine | | Synonyms: | 5-Bromo-4,6-dimethoxypyrimidine ,97%;Pyrimidine, 5-bromo-4,6-dimethoxy-;5-Bromo-4,6-dimethoxypyrimidine ,97% ISO 9001:2015 REACH;5-BROMO-4,6-DIMETHOXYPYRIMIDINE | | CAS: | 4319-77-1 | | MF: | C6H7BrN2O2 | | MW: | 219.04 | | EINECS: | | | Product Categories: | | | Mol File: | 4319-77-1.mol |  |
| | 5-Bromo-4,6-dimethoxypyrimidine Chemical Properties |
| Melting point | 149-151℃ | | Boiling point | 288℃ | | density | 1.563 | | Fp | 128℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | -0.03±0.26(Predicted) | | InChI | InChI=1S/C6H7BrN2O2/c1-10-5-4(7)6(11-2)9-3-8-5/h3H,1-2H3 | | InChIKey | XBALMYGYANOULM-UHFFFAOYSA-N | | SMILES | C1=NC(OC)=C(Br)C(OC)=N1 |
| | 5-Bromo-4,6-dimethoxypyrimidine Usage And Synthesis |
| Chemical Properties | White powder |
| | 5-Bromo-4,6-dimethoxypyrimidine Preparation Products And Raw materials |
|