|  | |  |  | 5-Bromo-4,6-dimethoxypyrimidine Basic information | 
 | Product Name: | 5-Bromo-4,6-dimethoxypyrimidine |  | Synonyms: | 5-Bromo-4,6-dimethoxypyrimidine ,97%;Pyrimidine, 5-bromo-4,6-dimethoxy-;5-Bromo-4,6-dimethoxypyrimidine ,97% ISO 9001:2015 REACH;5-BROMO-4,6-DIMETHOXYPYRIMIDINE |  | CAS: | 4319-77-1 |  | MF: | C6H7BrN2O2 |  | MW: | 219.04 |  | EINECS: |  |  | Product Categories: |  |  | Mol File: | 4319-77-1.mol |  |  | 
|  |  | 5-Bromo-4,6-dimethoxypyrimidine Chemical Properties | 
 | Melting point | 149-151℃ |  | Boiling point | 288℃ |  | density | 1.563 |  | Fp | 128℃ |  | storage temp. | Keep in dark place,Sealed in dry,Room Temperature |  | pka | -0.03±0.26(Predicted) |  | InChI | InChI=1S/C6H7BrN2O2/c1-10-5-4(7)6(11-2)9-3-8-5/h3H,1-2H3 |  | InChIKey | XBALMYGYANOULM-UHFFFAOYSA-N |  | SMILES | C1=NC(OC)=C(Br)C(OC)=N1 | 
|  |  | 5-Bromo-4,6-dimethoxypyrimidine Usage And Synthesis | 
 | Chemical Properties | White powder | 
|  |  | 5-Bromo-4,6-dimethoxypyrimidine Preparation Products And Raw materials | 
 |