| 
 |  | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Basic information |  
  
 |  | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Chemical Properties |  
 | Boiling point  | 340.2±15.0 °C(Predicted) |  | density  | 0.967±0.06 g/cm3(Predicted) |  | storage temp.  | 0-6°C |  | solubility  | Chloroform (Slightly), Hexane (Slightly), Methanol (Slightly) |  | form  | Oil |  | color  | Pale Yellow to Light Yellow |  | InChI | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 |  | InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N |  | SMILES | C1(CC(OCCC)=O)CCC(=O)C1CCCCC |  | EPA Substance Registry System | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester (158474-72-7) |  
  
 |  | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Usage And Synthesis |  
  
 |  | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Preparation Products And Raw materials |  
  |