|
| | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Basic information |
| | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Chemical Properties |
| Boiling point | 340.2±15.0 °C(Predicted) | | density | 0.967±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Hexane (Slightly), Methanol (Slightly) | | form | Oil | | color | Pale Yellow to Light Yellow | | InChI | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 | | InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N | | SMILES | C1(CC(OCCC)=O)CCC(=O)C1CCCCC | | EPA Substance Registry System | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester (158474-72-7) |
| | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Usage And Synthesis |
| | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester Preparation Products And Raw materials |
|