|
| | 2,4-Quinolinediol Basic information |
| | 2,4-Quinolinediol Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 287.44°C (rough estimate) | | density | 1.2480 (rough estimate) | | refractive index | 1.5050 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Aqueous Base (Slightly), DMSO (Slightly) | | pka | 4.50±1.00(Predicted) | | form | Powder | | color | Very light brown | | Water Solubility | Insoluble in water | | BRN | 129767 | | InChI | InChI=1S/C9H7NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h1-5H,(H2,10,11,12) | | InChIKey | HDHQZCHIXUUSMK-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(O)=CC1=O | | LogP | 1.020 (est) | | CAS DataBase Reference | 86-95-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Quinolinediol (mainly keto form)(86-95-3) | | EPA Substance Registry System | 2(1H)-Quinolinone, 4-hydroxy- (86-95-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | FG7300000 | | TSCA | Yes | | HazardClass | IRRITANT | | HS Code | 29334900 |
| | 2,4-Quinolinediol Usage And Synthesis |
| Chemical Properties | very light brown powder | | Uses | 2,4-Quinolinediol is a coupling component of yellow azo dyes, also used as pharmaceutical intermediates. | | Definition | ChEBI: A heteroaryl hydroxy compound that is 2-quinolone substituted at position 4 by a hydroxy group. |
| | 2,4-Quinolinediol Preparation Products And Raw materials |
|