|  | |  |  | 2,4-Quinolinediol Basic information | 
|  |  | 2,4-Quinolinediol Chemical Properties | 
 | Melting point | >300 °C(lit.) |  | Boiling point | 287.44°C (rough estimate) |  | density | 1.2480 (rough estimate) |  | refractive index | 1.5050 (estimate) |  | storage temp. | Inert atmosphere,Room Temperature |  | solubility | Aqueous Base (Slightly), DMSO (Slightly) |  | pka | 4.50±1.00(Predicted) |  | form | Powder |  | color | Very light brown |  | Water Solubility | Insoluble in water |  | BRN | 129767 |  | InChI | InChI=1S/C9H7NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h1-5H,(H2,10,11,12) |  | InChIKey | HDHQZCHIXUUSMK-UHFFFAOYSA-N |  | SMILES | N1C2=C(C=CC=C2)C(O)=CC1=O |  | LogP | 1.020 (est) |  | CAS DataBase Reference | 86-95-3(CAS DataBase Reference) |  | NIST Chemistry Reference | 2,4-Quinolinediol (mainly keto form)(86-95-3) |  | EPA Substance Registry System | 2(1H)-Quinolinone, 4-hydroxy- (86-95-3) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 26-37/39 |  | WGK Germany | 3 |  | RTECS | FG7300000 |  | TSCA | Yes |  | HazardClass | IRRITANT |  | HS Code | 29334900 | 
|  |  | 2,4-Quinolinediol Usage And Synthesis | 
 | Chemical Properties | very light brown powder |  | Uses | 2,4-Quinolinediol is a coupling component of yellow azo dyes, also used as pharmaceutical intermediates. |  | Definition | ChEBI: A heteroaryl hydroxy compound that is 2-quinolone substituted at position 4 by a hydroxy group. | 
|  |  | 2,4-Quinolinediol Preparation Products And Raw materials | 
 |