|
| | 2-Amino-3-fluorobenzotrifluoride Basic information |
| Product Name: | 2-Amino-3-fluorobenzotrifluoride | | Synonyms: | ALPHA,ALPHA,ALPHA,6-TETRAFLUORO-O-TOLUIDINE;2-FLUORO-6-(TRIFLUOROMETHYL)ANILINE;2-AMINO-3-FLUOROBENZOTRIFLUORIDE;2-Amino-3-fluorobenzotrifluoride 98%;2-Amino-3-fluorobenzotrifluoride98%;2-Amino-3-fluorobenzotrifluoride, α,α,α,6-Tetrafluoro-o-toluidine;BenzenaMine, 2-fluoro-6-(trifluoroMethyl)-;2-Fluoro-6-(trifluoroMethyl)aniline 98% | | CAS: | 144851-61-6 | | MF: | C7H5F4N | | MW: | 179.11 | | EINECS: | 626-647-4 | | Product Categories: | | | Mol File: | 144851-61-6.mol |  |
| | 2-Amino-3-fluorobenzotrifluoride Chemical Properties |
| Boiling point | 155 °C(lit.) | | density | 1.388 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 128 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 0.07±0.10(Predicted) | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C7H5F4N/c8-5-3-1-2-4(6(5)12)7(9,10)11/h1-3H,12H2 | | InChIKey | CQSFHEFEKDRLKE-UHFFFAOYSA-N | | SMILES | C1(N)=C(C(F)(F)F)C=CC=C1F | | CAS DataBase Reference | 144851-61-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Amino-3-fluorobenzotrifluoride(144851-61-6) |
| | 2-Amino-3-fluorobenzotrifluoride Usage And Synthesis |
| Uses | 2-Fluoro-6-(trifluoromethyl)aniline may be used in the preparation of bis[4-amino-3-fluoro-5-(trifluoromethyl)phenyl]methane. | | General Description | 2-Fluoro-6-(trifluoromethyl)aniline is a fluorinated building block. |
| | 2-Amino-3-fluorobenzotrifluoride Preparation Products And Raw materials |
|
