|
| | 4-methyl-1H-benzotriazole Basic information |
| | 4-methyl-1H-benzotriazole Chemical Properties |
| Melting point | 139-143°C | | Boiling point | 360.6±11.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | storage temp. | Room temperature. | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | neat | | pka | 8.74±0.40(Predicted) | | color | Dark Orange to Very Dark Brown | | BRN | 119183 | | InChI | InChI=1S/C7H7N3/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3,(H,8,9,10) | | InChIKey | CMGDVUCDZOBDNL-UHFFFAOYSA-N | | SMILES | N1C2=C(C)C=CC=C2N=N1 |
| Hazard Codes | Xn | | Risk Statements | 20/22-36-52/53 | | Safety Statements | 26-61 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 4-methyl-1H-benzotriazole Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | A benzotriazole derivative as corrosion inhibitor. | | Uses | 4-Methylbenzotriazole is a benzotriazole derivative as corrosion inhibitor. | | Uses | A labelled benzotriazole derivative as corrosion inhibitor. | | General Description | 4-Methyl-1H-benzotriazole is an additive in formulated aircraft deicing and anti-icing fluids (ADAFs) mixture. |
| | 4-methyl-1H-benzotriazole Preparation Products And Raw materials |
|
