|
| | 4-Bromo-2-hydroxybenzoic acid Basic information |
| | 4-Bromo-2-hydroxybenzoic acid Chemical Properties |
| Melting point | 164-165°C | | Boiling point | 330.2±32.0 °C(Predicted) | | density | 1.861±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 2.71±0.10(Predicted) | | color | Orange | | InChI | InChI=1S/C7H5BrO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,(H,10,11) | | InChIKey | FYAKLZKQJDBBKW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Br)C=C1O | | CAS DataBase Reference | 1666-28-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-52/53 | | Safety Statements | 22-24/25-61 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2918290090 |
| | 4-Bromo-2-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | 4-Bromo-2-hydroxybenzoic acid is a solid at normal temperature and pressure. It is stable at normal temperature and decomposes into phenol and carbon dioxide after rapid heating. It has some acidic properties. | | Uses | 2-Hydroxy-4-bromobenzoic acid is used as an anti-scorch agent in drug molecules and rubber industry, as well as an intermediate in the production of ultraviolet absorbers and foaming agents. |
| | 4-Bromo-2-hydroxybenzoic acid Preparation Products And Raw materials |
|