|  | |  |  | 4-Bromo-2-hydroxybenzoic acid Basic information | 
|  |  | 4-Bromo-2-hydroxybenzoic acid Chemical Properties | 
 | Melting point | 164-165°C |  | Boiling point | 330.2±32.0 °C(Predicted) |  | density | 1.861±0.06 g/cm3(Predicted) |  | storage temp. | Keep in dark place,Inert atmosphere,Room temperature |  | form | powder |  | pka | 2.71±0.10(Predicted) |  | color | Orange |  | InChI | InChI=1S/C7H5BrO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,(H,10,11) |  | InChIKey | FYAKLZKQJDBBKW-UHFFFAOYSA-N |  | SMILES | C(O)(=O)C1=CC=C(Br)C=C1O |  | CAS DataBase Reference | 1666-28-0(CAS DataBase Reference) | 
| Hazard Codes | Xi,Xn |  | Risk Statements | 22-52/53 |  | Safety Statements | 22-24/25-61 |  | RIDADR | 2811 |  | WGK Germany | 3 |  | HazardClass | IRRITANT |  | PackingGroup | Ⅲ |  | HS Code | 2918290090 | 
|  |  | 4-Bromo-2-hydroxybenzoic acid Usage And Synthesis | 
 | Chemical Properties | 4-Bromo-2-hydroxybenzoic acid is a solid at normal temperature and pressure. It is stable at normal temperature and decomposes into phenol and carbon dioxide after rapid heating. It has some acidic properties. |  | Uses | 2-Hydroxy-4-bromobenzoic acid is used as an anti-scorch agent in drug molecules and rubber industry, as well as an intermediate in the production of ultraviolet absorbers and foaming agents. | 
|  |  | 4-Bromo-2-hydroxybenzoic acid Preparation Products And Raw materials | 
 |