|
| | Ethyl 2,4-dihydroxy-6-methyl-3-pyridinecarboxylate Basic information |
| Product Name: | Ethyl 2,4-dihydroxy-6-methyl-3-pyridinecarboxylate | | Synonyms: | 3-PYRIDINECARBOXYLIC ACID, 2,4-DIHYDROXY-6-METHYL-,ETHYL ESTER;2,4-DIHYDROXY-6-METHYL-3-PYRIDINECARBOXYLIC ACID ETHYL ESTER;BUTTPARK 153\57-17;ETHYL ESTER 2,4-DIHYDROXY-6-METHYL-3-PYRIDINE CARBOXYLIC ACID;ETHYL 2,4-DIHYDROXY-6-METHYL-3-PYRIDINECARBONATE;ETHYL 2,4-DIHYDROXY-6-METHYL-3-PYRIDINECARBOXYLATE;ETHYL 2,4-DIHYDROXY-6-METHYLNICOTINATE;ETHYL 2,4-DIHYDROXY-6-METHYLPYRIDINE-3-CARBOXYLATE | | CAS: | 70254-52-3 | | MF: | C9H11NO4 | | MW: | 197.19 | | EINECS: | 676-990-9 | | Product Categories: | Esters;Pyridine;blocks;Carboxes;Pyridines;Heterocycle-Pyridine series | | Mol File: | 70254-52-3.mol |  |
| | Ethyl 2,4-dihydroxy-6-methyl-3-pyridinecarboxylate Chemical Properties |
| Melting point | 205 °C | | Boiling point | 446.0±40.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.08±0.28(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C9H11NO4/c1-3-14-9(13)7-6(11)4-5(2)10-8(7)12/h4H,3H2,1-2H3,(H2,10,11,12) | | InChIKey | CMCZAWPDHHYFPU-UHFFFAOYSA-N | | SMILES | C1(O)=NC(C)=CC(O)=C1C(OCC)=O | | CAS DataBase Reference | 70254-52-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | Ethyl 2,4-dihydroxy-6-methyl-3-pyridinecarboxylate Usage And Synthesis |
| Uses | Ethyl 2,4-Dihydroxy-6-methylnicotinate, is a building block used for various chemical compounds. It is used for the synthesis of analogs of Lucanthone, having antitumor and bactericidal properties. |
| | Ethyl 2,4-dihydroxy-6-methyl-3-pyridinecarboxylate Preparation Products And Raw materials |
|
