|
| | 1H,1H,2H,2H-Perfluorooctanesulfonic acid Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorooctanesulfonic acid | | Synonyms: | (1H,1H,2H,2H)-Perfluorooctanesulfonic];1-Octanesulfonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-;1H,1H,2H,2H-Perfluorooctanesulphonic acid 98%;1H,1H,2H,2H-Perfluorooctanesulphonicacid98%;2-(Perfluorohexyl)ethane-1-sulfonic acid;2-(Tridecafluorohexyl)ethanesulfonic acid;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctane-1-sulfonic acid;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctane-1-sulphonic acid | | CAS: | 27619-97-2 | | MF: | C8H5F13O3S | | MW: | 428.17 | | EINECS: | 248-580-6 | | Product Categories: | | | Mol File: | 27619-97-2.mol |  |
| | 1H,1H,2H,2H-Perfluorooctanesulfonic acid Chemical Properties |
| density | 1,25 g/cm3 | | vapor pressure | 1.96Pa at 20℃ | | solubility | Acetone: Slightly soluble,Chloroform: Slightly soluble,DMSO: Slightly soluble,Methanol: Slightly soluble | | form | A low-melting solid | | pka | 1.31±0.50(Predicted) | | Water Solubility | 658g/L at 20℃ | | InChI | InChI=1S/C8H5F13O3S/c9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H,22,23,24) | | InChIKey | VIONGDJUYAYOPU-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | 1-Octanesulfonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- (27619-97-2) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3265 | | Hazard Note | Corrosive | | HazardClass | IRRITANT, CORROSIVE | | HS Code | 2904990090 |
| | 1H,1H,2H,2H-Perfluorooctanesulfonic acid Usage And Synthesis |
| Chemical Properties | White to Brown Solid. | | Uses | 1H,1H,2H,2H-Perfluorooctanesulfonic acid is an aliphatic compound for fluorinated surfactant synthesis. | | Application | 1H,1H,2H,2H-Perfluorooctanesulfonic acid can functionalize gallium nitride (GaN) to tune the optical properties, which can potentially be used in chemical sensor based applications. It can modify the surface characteristics of copper substrates that find usage in printed circuit boards as copper foils. It can also be coated on the indium tin oxide substrate, which may be utilized in organic light emitting diodes (OLEDs) and organic photovoltaics (OPVs). | | General Description | 1H,1H,2H,2H-Perfluorooctanesulfonic acid is a fluoroalkyl phosphonic acid that contains 8 fluorinated carbon atoms. It forms a self-assembled layer on the substrate due to the adhesion of the phosphonates. The surface adhesion is a component of the acid base linkage that is enhanced by the hydroxyl groups. | | Flammability and Explosibility | Notclassified |
| | 1H,1H,2H,2H-Perfluorooctanesulfonic acid Preparation Products And Raw materials |
| Raw materials | Thiocyanic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester |
|