|  | |  |  | 3-Hydroxy-4-nitrobenzoic acid Basic information | 
|  |  | 3-Hydroxy-4-nitrobenzoic acid Chemical Properties | 
 | Melting point | 229-231 °C (lit.) |  | Boiling point | 316.77°C (rough estimate) |  | density | 1.6074 (rough estimate) |  | refractive index | 1.6280 (estimate) |  | storage temp. | Inert atmosphere,Room Temperature |  | solubility | 1.08g/l (calculated) |  | pka | 3.30±0.10(Predicted) |  | form | Powder |  | color | Yellow to brown |  | Water Solubility | insoluble |  | BRN | 2107564 |  | InChI | InChI=1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |  | InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |  | SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(O)=C1 |  | CAS DataBase Reference | 619-14-7(CAS DataBase Reference) |  | NIST Chemistry Reference | 3-Hydroxy-4-nitrobenzoic acid(619-14-7) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 26-36 |  | WGK Germany | 3 |  | Hazard Note | Irritant |  | HS Code | 29182990 | 
|  |  | 3-Hydroxy-4-nitrobenzoic acid Usage And Synthesis | 
 | Chemical Properties | yellow to brownish powder |  | Uses | 3-Hydroxy-4-nitrobenzoic acid is a compound that is capable of inhibiting chloroplast development in linseed and oat seedlings. 3-Hydroxy-4-nitrobenzoic acid also exhibits inhibitory effects on Ras proteins, making them potentially useful compounds in treating cancer. | 
|  |  | 3-Hydroxy-4-nitrobenzoic acid Preparation Products And Raw materials | 
 |