|
| | 3-Hydroxy-4-nitrobenzoic acid Basic information |
| | 3-Hydroxy-4-nitrobenzoic acid Chemical Properties |
| Melting point | 229-231 °C (lit.) | | Boiling point | 316.77°C (rough estimate) | | density | 1.6074 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 1.08g/l (calculated) | | pka | 3.30±0.10(Predicted) | | form | Powder | | color | Yellow to brown | | Water Solubility | insoluble | | BRN | 2107564 | | InChI | InChI=1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) | | InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(O)=C1 | | CAS DataBase Reference | 619-14-7(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Hydroxy-4-nitrobenzoic acid(619-14-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29182990 |
| | 3-Hydroxy-4-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | yellow to brownish powder | | Uses | 3-Hydroxy-4-nitrobenzoic acid is a compound that is capable of inhibiting chloroplast development in linseed and oat seedlings. 3-Hydroxy-4-nitrobenzoic acid also exhibits inhibitory effects on Ras proteins, making them potentially useful compounds in treating cancer. |
| | 3-Hydroxy-4-nitrobenzoic acid Preparation Products And Raw materials |
|