|
| | Silybin Basic information |
| | Silybin Chemical Properties |
| Melting point | 152-153°C | | Boiling point | 793.0±60.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetone (Sparingly, Sonicated, Heated), DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 7.39±0.60(Predicted) | | form | Solid | | color | Pale Yellow to Beige | | InChIKey | SEBFKMXJBCUCAI-DBMPWETRSA-N | | SMILES | [C@H]1(C2=CC=C3OC(CO)C(C4=CC=C(O)C(OC)=C4)OC3=C2)OC2=CC(O)=CC(O)=C2C(=O)[C@@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DJ2981770 |
| | Silybin Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | Hepatoprotectant. In nature, the flavonolignan Silybin occurs as a mixture of two diastereomers, Silybin A and Silybin B. | | Uses | Reference standard in the analysis of herbal medicinal products. | | General Description | Produced and qualified by HWI pharma services GmbH. Exact content by quantitative NMR can be found on the certificate. |
| | Silybin Preparation Products And Raw materials |
|