|
| | Diatrizoic Acid Dihydrate Basic information |
| Product Name: | Diatrizoic Acid Dihydrate | | Synonyms: | DIATRIZOIC ACID DIHYDRATE;DIATRIZOIC ACID USP;Diatrizoic acid;3,5-DIACETAMIDO-2,4,6-TRIIODOBENZIOCACID;Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo-, dihydrate;DIAZTRIZOICACID,DIHYDRATE;DIATRIZOICACID,DIHYDRATE,USP;3,5-DIACETAMIDO- 2,4,6-TRIIODOBENZOIC ACID (DIATRIZOIC ACID DIHYDRATE) | | CAS: | 50978-11-5 | | MF: | C11H11I3N2O5 | | MW: | 631.93 | | EINECS: | 204-223-6 | | Product Categories: | Organic acids;Enzyme InhibitorsPharmacopoeia (USP);Core Bioreagents;Pharmacopoeia A-Z;Research Essentials | | Mol File: | 50978-11-5.mol |  |
| | Diatrizoic Acid Dihydrate Chemical Properties |
| storage temp. | 2-8°C | | solubility | Very slightly soluble in water and in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. | | form | neat | | pka | pKa 3.4 (Uncertain) | | Stability: | Light Sensitive | | InChI | InChI=1S/C11H9I3N2O4.H2O/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18;/h1-2H3,(H,15,17)(H,16,18)(H,19,20);1H2 | | InChIKey | JHQKUXXJPHSPOL-UHFFFAOYSA-N | | SMILES | N(C1C(=C(NC(=O)C)C(I)=C(C(=O)O)C=1I)I)C(=O)C.O | | CAS DataBase Reference | 50978-11-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924296000 |
| | Diatrizoic Acid Dihydrate Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder. | | Uses | Diagnostic aid (radiopaque medium). | | Definition | ChEBI: The dihydrate form of amidotrizoic acid. Both the dihydrate and the anhydrous form are used as X-ray contrast media. |
| | Diatrizoic Acid Dihydrate Preparation Products And Raw materials |
|