|
| | Potassium triphosphate Basic information |
| Product Name: | Potassium triphosphate | | Synonyms: | PotassiuM Tripolyphosphate 50%;Triphosphoricacid, potassiuM salt (1:5);POTASSIUM TRIPHOSPHATE;POTASSIUM TRIPOLYPHOSPHATE;PENTAPOTASSIUM TRIPHOSPHATE;Triphosphoricacid,pentapotassiumsalt;PotassiumTripolyphosphateFoodGrade;PotassiumTripolyphosphateTechGrade | | CAS: | 13845-36-8 | | MF: | H6KO10P3 | | MW: | 298.06 | | EINECS: | 237-574-9 | | Product Categories: | Inorganics;metal phosphate compound | | Mol File: | 13845-36-8.mol |  |
| | Potassium triphosphate Chemical Properties |
| Melting point | 620°C | | density | 2,54 g/cm3 | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | Specific Gravity | 2.54 | | color | white | | Odor | odorless | | InChI | InChI=1S/K.H5O10P3.H/c;1-11(2,3)9-13(7,8)10-12(4,5)6;/h;(H,7,8)(H2,1,2,3)(H2,4,5,6); | | InChIKey | VPGOTXNIRSCNLD-UHFFFAOYSA-N | | SMILES | O(P(O)(O)=O)P(O)(=O)OP(O)(O)=O.[KH] | | CAS DataBase Reference | 13845-36-8(CAS DataBase Reference) | | EPA Substance Registry System | Potassium tripolyphosphate (13845-36-8) |
| | Potassium triphosphate Usage And Synthesis |
| Chemical Properties | White, crystalline solid. Solubility in water
(26C) more than 140 g/100 m L water.
| | Uses | Water-treating compounds, cleaners, specialty
fertilizers, sequestrant.
|
| | Potassium triphosphate Preparation Products And Raw materials |
|
