|
| Product Name: | 5-alpha-Dihydroprogesterone | | Synonyms: | 5-Alpha-Dihydro Progesterone-d8;Pregnane-3,20-dlone;ALLOPREGNANE-3,20-DIONE;ALLOPREGNAN-3,20-DIONE;ALLOPREGNANDIONE;(5S,8R,9S,10S,13S,14S,17S)-17-ACETYL-10,13-DIMETHYL-HEXADECAHYDRO-CYCLOPENTA[A]PHENANTHREN-3-ONE;5 A-PREGNANE-3 20-DIONE;5A-PREGNAN-3,20-DIONE | | CAS: | 566-65-4 | | MF: | C21H32O2 | | MW: | 316.48 | | EINECS: | 209-297-3 | | Product Categories: | Steroids;566-65-4 | | Mol File: | 566-65-4.mol |  |
| | 5-alpha-Dihydroprogesterone Chemical Properties |
| Melting point | 200 °C | | Boiling point | 429.2±38.0 °C(Predicted) | | density | 1.048±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19H,4-12H2,1-3H3/t14?,16-,17+,18-,19-,20-,21+/m0/s1 | | InChIKey | XMRPGKVKISIQBV-CVHNGYJVSA-N | | SMILES | C1(=O)CC2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H](C(=O)C)CC3)CC2 | | CAS DataBase Reference | 566-65-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3,20-Allopregnanedione(566-65-4) |
| WGK Germany | 3 | | RTECS | TU4157150 | | HS Code | 2937.29.9095 |
| | 5-alpha-Dihydroprogesterone Usage And Synthesis |
| Description | 5α-Dihydroprogesterone (5α-DHP) is an endogenous progestogen and neurosteroid that is synthesized from progesterone.It is also an intermediate in the synthesis of allopregnanolone and isopregnanolone from progesterone. | | In vitro | 5a-Pregnane-3,20-dione decreases cell-substrate attachment, adhesion plaques, vinculin expression, and polymerizes F-actin in MCF-7 breast cancer cells. | | Uses | (5α)-Pregnane-3,20-dione exerts neuroprotective effects in chronic autoimmune encephalomyelitis (EAE). The neuroactivity of the steroid acts as a therapeutic agent for multiple sclerosis. | | Definition | ChEBI: 5alpha-pregnane-3,20-dione is a C21-steroid hormone that is 5alpha-pregnane substituted by oxo groups at positions 3 and 20. It is a metabolite of progestrone. It has a role as a human metabolite and a progestogen. It is a 20-oxo steroid, a C21-steroid hormone and a 3-oxo-5alpha-steroid. It is functionally related to a progesterone. It derives from a hydride of a 5alpha-pregnane. | | Biochem/physiol Actions | (5α)-Pregnane-3,20-dione is a high-level metabolite of progesterone in breast cancer tissue (but not normal breast tissue); promotes cell proliferation and detachment. Receptors appear only on the cell surface of MCF-7 breast cancer cells, not on nuclei where most other steroid receptors are located. |
| | 5-alpha-Dihydroprogesterone Preparation Products And Raw materials |
|