|
| | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Basic information |
| Product Name: | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL | | Synonyms: | 2,3,4,2',3',4'-Hexachlorobiphenyl;2,3,4,2’,3’,4’-hexachlorobiphenyl;pcb128;PCB-128;1,1'-BIPHENYL,2,2',3,3',4,;Inchi=1/C12H4cl6/C13-7-3-1-5(9(15)11(7)17)6-2-4-8(14)12(18)10(6)16/H1-4;2,2',3,3',4,4'-HEXACHLOROBIPHENYL;2.2'.3.3'.4.4'-Hexachlorobiphenyl 20mg [38380-07-3] | | CAS: | 38380-07-3 | | MF: | C12H4Cl6 | | MW: | 360.88 | | EINECS: | | | Product Categories: | | | Mol File: | 38380-07-3.mol |  |
| | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Chemical Properties |
| Melting point | 151°C | | Boiling point | 446.99°C (rough estimate) | | density | 1.5940 (rough estimate) | | refractive index | 1.6270 (rough estimate) | | storage temp. | room temp | | solubility | Acetonitrile (Slightly, Heated, Sonicated), Chloroform (Slightly), Ethyl Acetate | | form | Solid | | color | White to Pale Beige | | Water Solubility | 0.3497ug/L(25 ºC) | | CAS DataBase Reference | 38380-07-3 | | EPA Substance Registry System | 2,2',3,3',4,4'-Hexachlorobiphenyl (38380-07-3) |
| | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Usage And Synthesis |
| Uses | 2,2'',3,3'',4,4''-Hexachlorobiphenyl is a polychlorinated biphenyl (PCB) found in air, soil, mammals, and marine animals. |
| | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Preparation Products And Raw materials |
|