|  | |  |  | 3,5-Difluorophenol Basic information | 
 | Product Name: | 3,5-Difluorophenol |  | Synonyms: | 3,5-DIFLUOROPHENOL;Phenol,3,5-difluoro-;3,5-Difluorophenol,98+%;3,5-Difluorophenol 99%;3,5-Difluorophenol99%;3,5-Diflourophenol;3,5-Difluorophenol, 99% 1GR;3, 5 - two fluorine phenol |  | CAS: | 2713-34-0 |  | MF: | C6H4F2O |  | MW: | 130.09 |  | EINECS: | 608-047-4 |  | Product Categories: | Aromatic Phenols;Fluorobenzene;Phenol&Thiophenol&Mercaptan;Fluorophenols;Fluorobenzene Series;Organic  Building  Blocks;Oxygen  Compounds;Phenols;Heterocyclic Acids;intermediate |  | Mol File: | 2713-34-0.mol |  |  | 
|  |  | 3,5-Difluorophenol Chemical Properties | 
 | Melting point | 54-57 °C (lit.) |  | Boiling point | 65-68°C 1mm |  | density | 1.2483 (estimate) |  | Fp | 159 °F |  | storage temp. | Inert atmosphere,Room Temperature |  | solubility | ethanol: soluble50, clear, colorless to faint yellow or tan (mg/mL) |  | pka | 7.97±0.10(Predicted) |  | form | Crystals |  | color | White to beige |  | BRN | 2078616 |  | InChI | InChI=1S/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |  | InChIKey | HJSSBIMVTMYKPD-UHFFFAOYSA-N |  | SMILES | C1(O)=CC(F)=CC(F)=C1 |  | CAS DataBase Reference | 2713-34-0(CAS DataBase Reference) |  | NIST Chemistry Reference | 3,5-Difluorophenol(2713-34-0) | 
|  |  | 3,5-Difluorophenol Usage And Synthesis | 
 | Chemical Properties | white to beige crystals |  | Uses | 3,5-Difluorophenol is an important medicine, pesticide, and liquid crystal material intermediate, mainly used in the synthesis of liquid crystal materials and antifungal agents, and also used in the synthesis of dyes, plastics and rubber additives. | 
|  |  | 3,5-Difluorophenol Preparation Products And Raw materials | 
 |