|
| | Di-tert-butyl Chloromethyl Phosphate Basic information |
| Product Name: | Di-tert-butyl Chloromethyl Phosphate | | Synonyms: | Di-tert-butyl Chloromethyl Phosphate;PHOSPHORIC ACI DI-T-BUTYL EXTER CHLOROMETHYL ESTER;Phosphoric acid, chloroMethyl bis(1,1-diMethylethyl) ester;Phosphoric acid di-tert-butyl chloromethyl ester;Chloromethyl di-tert-butyl phosphate;Phosphoric acid ditert-butyl ester chloromethyl ester;Di-tert-butyl (chloromethyl) phosphate (stabilized with potassium carbonate);Fostemsavir-SM | | CAS: | 229625-50-7 | | MF: | C9H20ClO4P | | MW: | 258.68 | | EINECS: | | | Product Categories: | intermediates;SiChem | | Mol File: | 229625-50-7.mol |  |
| | Di-tert-butyl Chloromethyl Phosphate Chemical Properties |
| Boiling point | 272.9±23.0 °C(Predicted) | | density | 1.115±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Benzene (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Light yellow | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C9H20ClO4P/c1-8(2,3)13-15(11,12-7-10)14-9(4,5)6/h7H2,1-6H3 | | InChIKey | LNJAJHJFSKUCIR-UHFFFAOYSA-N | | SMILES | P(OC(C)(C)C)(OC(C)(C)C)(OCCl)=O | | CAS DataBase Reference | 229625-50-7 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | HS Code | 29199000 |
| | Di-tert-butyl Chloromethyl Phosphate Usage And Synthesis |
| Uses | Used as an intermediate for laboratory research. | | Synthesis | Di-tert-butyl (chloromethyl) phosphate, a key compound in the formation of many phosphon-oxymethyl pro-drugs, is prepared by reacting chloromethyl chlorosulfate (CMCS) with di-tert-butyl potassium phosphate (DTBPP) . |
| | Di-tert-butyl Chloromethyl Phosphate Preparation Products And Raw materials |
|
