|
| | Dehydroepiandrosterone acetate Basic information |
| | Dehydroepiandrosterone acetate Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 407.89°C (rough estimate) | | density | 1.0998 (rough estimate) | | vapor pressure | 0Pa at 20℃ | | refractive index | 1.5192 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | optical activity | [α]20/D +2.4°, c = 2 in ethanol | | Water Solubility | 11.5mg/L(temperature not stated) | | InChI | InChI=1/C21H30O3/c1-13(22)24-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23)21(17,3)11-9-18(16)20/h4,15-18H,5-12H2,1-3H3/t15-,16-,17-,18-,20-,21-/s3 | | InChIKey | NCMZQTLCXHGLOK-KJBVPOJVSA-N | | SMILES | C[C@]12CC[C@H](OC(=O)C)CC1=CC[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)CC[C@]21[H] |&1:1,4,13,15,21,25,r| | | LogP | 5.1 at 20℃ | | CAS DataBase Reference | 853-23-6 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | BV8396810 |
| | Dehydroepiandrosterone acetate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Menopausal syndrome | | Uses | A metabolite of Dehydroepiandrosterone. This mammalian pro-hormone promotes brain and immune function | | Definition | ChEBI: Prasterone acetate is a steroid ester. | | Flammability and Explosibility | Notclassified | | Biological Activity | Dehydroepiandrosterone acetate (DHEA, Androstenolone) is a kind of dehydroepiandrosterone derivatives. DHEA is an endogenous steroid hormone, which is considered to be a natural product/dietary supplement with many proposed benefits to humans. | | in vivo | Dehydroisoandrosterone implants increases aggression in a laboratory-based simulated territorial intrusion. Brains of Dehydroisoandrosterone-implanted birds show higher aromatase mRNA expression in the preoptic area (POA) and higher androgen receptor mRNA expression in the periventricular nucleus of the medial striatum (pvMSt) and ventromedial nucleus of the hypothalamus (VMH). The Dehydroisoandrosterone-induced increases in aromatase expression in the POA and androgen receptor expression in the pvMSt are consistent with previously reported seasonal increases in these markers associated with naturally elevated Dehydroisoandrosterone levels. Dehydroisoandrosterone supplementation (10.2 mg/kg) alone significantly increases mice body weight (BW), muscle weight, testosterone level, and glycogen contents (liver and muscle) when compared with SC group. |
| | Dehydroepiandrosterone acetate Preparation Products And Raw materials |
|
